ChemNet > CAS > 24023-71-0 2-Chloromethyl-5- (4-متوکسی فنیل) -1،2،4-oxadiazole؛ ؛ 2- (کلر متیل) -5- (4-متوکسی فنیل) -1،3،4-اکسادیازول؛
24023-71-0 2-Chloromethyl-5- (4-متوکسی فنیل) -1،2،4-oxadiazole؛ ؛ 2- (کلر متیل) -5- (4-متوکسی فنیل) -1،3،4-اکسادیازول؛
| نام محصول |
2-Chloromethyl-5- (4-متوکسی فنیل) -1،2،4-oxadiazole؛ ؛ 2- (کلر متیل) -5- (4-متوکسی فنیل) -1،3،4-اکسادیازول؛ |
| نام انگلیسی |
2-Chloromethyl-5-(4-methoxyphenyl)-1,2,4-oxadiazole; 2-(Chloromethyl)-5-(4-methoxyphenyl)-1,3,4-oxadiazole |
| میدان مغناطیسی |
C10H9ClN2O2 |
| وزن مولکولی |
224.6437 |
| InChI |
InChI=1/C10H9ClN2O2/c1-14-8-4-2-7(3-5-8)10-13-12-9(6-11)15-10/h2-5H,6H2,1H3 |
| شماره سیایاس |
24023-71-0 |
| ساختار مولکولی |
|
| تراکم |
1.278g/cm3 |
| نقطه ذوب |
91℃ |
| نقطه غلیان |
354.9°C at 760 mmHg |
| ضریب شکست |
1.547 |
| نقطه اشتعال |
168.4°C |
| فشار بخار |
6.63E-05mmHg at 25°C |
| خطر نمادها |
Xi:Irritant;
|
| کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|