2432-42-0 S-Ethyl thiopropionate
نام محصول |
S-Ethyl thiopropionate |
نام انگلیسی |
S-Ethyl thiopropionate; Thiopropionic acid S-ethyl ester; S-ethyl propanethioate |
میدان مغناطیسی |
C5H10OS |
وزن مولکولی |
118.1973 |
InChI |
InChI=1/C5H10OS/c1-3-5(6)7-4-2/h3-4H2,1-2H3 |
شماره سیایاس |
2432-42-0 |
تعداد کمیسیون اروپایی |
219-405-0 |
ساختار مولکولی |
|
تراکم |
0.967g/cm3 |
نقطه غلیان |
141.4°C at 760 mmHg |
ضریب شکست |
1.456 |
نقطه اشتعال |
36°C |
فشار بخار |
5.87mmHg at 25°C |
خطر نمادها |
|
کدهای خطر |
R10:Flammable.;
|
توضیحات ایمنی |
S16:Keep away from sources of ignition - No smoking.;
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|