ChemNet > CAS > 246862-63-5 2- (4-chloro-3.5-dimethylphenoxy) -3-nitropyridine؛
246862-63-5 2- (4-chloro-3.5-dimethylphenoxy) -3-nitropyridine؛
| نام محصول |
2- (4-chloro-3.5-dimethylphenoxy) -3-nitropyridine؛ |
| نام انگلیسی |
2-(4-chloro-3,5-dimethylphenoxy)-3-nitropyridine; |
| میدان مغناطیسی |
C13H11ClN2O3 |
| وزن مولکولی |
278.691 |
| InChI |
InChI=1/C13H11ClN2O3/c1-8-6-10(7-9(2)12(8)14)19-13-11(16(17)18)4-3-5-15-13/h3-7H,1-2H3 |
| شماره سیایاس |
246862-63-5 |
| ساختار مولکولی |
|
| تراکم |
1.329g/cm3 |
| نقطه ذوب |
80℃ |
| نقطه غلیان |
382.6°C at 760 mmHg |
| ضریب شکست |
1.601 |
| نقطه اشتعال |
185.2°C |
| فشار بخار |
1.03E-05mmHg at 25°C |
| توضیحات ایمنی |
S24/25:Avoid contact with skin and eyes.;
|
|