260-94-6 Acridine
نام محصول |
Acridine |
نام انگلیسی |
Acridine; Dibenzo[b,e]pyridine |
میدان مغناطیسی |
C13H9N |
وزن مولکولی |
179.2173 |
InChI |
InChI=1/C13H9N/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)14-12/h1-9H |
شماره سیایاس |
260-94-6 |
تعداد کمیسیون اروپایی |
205-971-6 |
ساختار مولکولی |
|
تراکم |
1.187g/cm3 |
نقطه ذوب |
105-110℃ |
نقطه غلیان |
346.7°C at 760 mmHg |
ضریب شکست |
1.726 |
نقطه اشتعال |
153.8°C |
فشار بخار |
0.000113mmHg at 25°C |
خطر نمادها |
Xn:Harmful;
|
کدهای خطر |
R22:Harmful if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|