2642-98-0 6-Aminochrysene
نام محصول |
6-Aminochrysene |
نام انگلیسی |
6-Aminochrysene; 6-Chrysenamine; chrysen-6-ylamine; chrysen-6-amine |
میدان مغناطیسی |
C18H13N |
وزن مولکولی |
243.3025 |
InChI |
InChI=1/C18H13N/c19-18-11-17-13-6-2-1-5-12(13)9-10-15(17)14-7-3-4-8-16(14)18/h1-11H,19H2 |
شماره سیایاس |
2642-98-0 |
تعداد کمیسیون اروپایی |
220-149-7 |
ساختار مولکولی |
|
تراکم |
1.253g/cm3 |
نقطه ذوب |
206-211℃ |
نقطه غلیان |
501.2°C at 760 mmHg |
ضریب شکست |
1.813 |
نقطه اشتعال |
286.9°C |
فشار بخار |
3.56E-10mmHg at 25°C |
خطر نمادها |
Xn:Harmful;
|
کدهای خطر |
|
توضیحات ایمنی |
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|