ChemNet > CAS > 26547-51-3 8-Phenyloctanoic acid
26547-51-3 8-Phenyloctanoic acid
| نام محصول |
8-Phenyloctanoic acid |
| نام انگلیسی |
8-Phenyloctanoic acid; 8-phenyloctanoate; 8-Phenyl-1-octanoic acid |
| میدان مغناطیسی |
C14H19O2 |
| وزن مولکولی |
219.3 |
| InChI |
InChI=1/C14H20O2/c15-14(16)12-8-3-1-2-5-9-13-10-6-4-7-11-13/h4,6-7,10-11H,1-3,5,8-9,12H2,(H,15,16)/p-1 |
| شماره سیایاس |
26547-51-3 |
| ساختار مولکولی |
|
| نقطه غلیان |
369.9°C at 760 mmHg |
| نقطه اشتعال |
266.9°C |
| فشار بخار |
3.98E-06mmHg at 25°C |
| خطر نمادها |
|
| کدهای خطر |
R36/38:Irritating to eyes and skin.;
|
| توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
