ChemNet > CAS > 27464-82-0 2,5-Dimethyl-1,3,4-thiadiazole
27464-82-0 2,5-Dimethyl-1,3,4-thiadiazole
نام محصول |
2,5-Dimethyl-1,3,4-thiadiazole |
نام انگلیسی |
2,5-Dimethyl-1,3,4-thiadiazole;1,3,4-Thiadiazole, 2,5-dimethyl-; 2,5-Dimethylthiadiazole; NSC 93787 |
میدان مغناطیسی |
C4H6N2S |
وزن مولکولی |
114.1688 |
InChI |
InChI=1/C4H6N2S/c1-3-5-6-4(2)7-3/h1-2H3 |
شماره سیایاس |
27464-82-0 |
تعداد کمیسیون اروپایی |
248-473-4 |
ساختار مولکولی |
|
تراکم |
1.166g/cm3 |
نقطه ذوب |
62-65℃ |
نقطه غلیان |
202.5°C at 760 mmHg |
ضریب شکست |
1.534 |
نقطه اشتعال |
81.2°C |
فشار بخار |
0.415mmHg at 25°C |
خطر نمادها |
Xi:Irritant;
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|