ChemNet > CAS > 282093-48-5 3-مورفولینو-4-تتراهیدرو-1H-پیرول-1-ylcyclobut-3-ene-1،2-dione؛ 3-مورفولین-4-ایل-4-پیرولیدین-1-ylcyclobut-3-ene-1،2-dione؛
282093-48-5 3-مورفولینو-4-تتراهیدرو-1H-پیرول-1-ylcyclobut-3-ene-1،2-dione؛ 3-مورفولین-4-ایل-4-پیرولیدین-1-ylcyclobut-3-ene-1،2-dione؛
نام محصول |
3-مورفولینو-4-تتراهیدرو-1H-پیرول-1-ylcyclobut-3-ene-1،2-dione؛ 3-مورفولین-4-ایل-4-پیرولیدین-1-ylcyclobut-3-ene-1،2-dione؛ |
نام انگلیسی |
3-morpholino-4-tetrahydro-1H-pyrrol-1-ylcyclobut-3-ene-1,2-dione;3-morpholin-4-yl-4-pyrrolidin-1-ylcyclobut-3-ene-1,2-dione |
میدان مغناطیسی |
C12H16N2O3 |
وزن مولکولی |
236.267 |
InChI |
InChI=1/C12H16N2O3/c15-11-9(13-3-1-2-4-13)10(12(11)16)14-5-7-17-8-6-14/h1-8H2 |
شماره سیایاس |
282093-48-5 |
ساختار مولکولی |
|
تراکم |
1.398g/cm3 |
نقطه ذوب |
251℃ |
نقطه غلیان |
359.9°C at 760 mmHg |
ضریب شکست |
1.629 |
نقطه اشتعال |
171.4°C |
فشار بخار |
2.31E-05mmHg at 25°C |
خطر نمادها |
Xi:Irritant;
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|