ChemNet > CAS > 2946-61-4 Dimethyl phenylphosphonite
2946-61-4 Dimethyl phenylphosphonite
نام محصول |
Dimethyl phenylphosphonite |
نام انگلیسی |
Dimethyl phenylphosphonite; Dimethoxyphenylphosphine; Phenyldimethoxyphosphine; Phenylphosphonous acid dimethyl ester |
میدان مغناطیسی |
C8H11O2P |
وزن مولکولی |
170.1455 |
InChI |
InChI=1/C8H11O2P/c1-9-11(10-2)8-6-4-3-5-7-8/h3-7H,1-2H3 |
شماره سیایاس |
2946-61-4 |
تعداد کمیسیون اروپایی |
220-960-6 |
ساختار مولکولی |
|
نقطه غلیان |
194.1°C at 760 mmHg |
نقطه اشتعال |
81°C |
فشار بخار |
0.628mmHg at 25°C |
خطر نمادها |
|
کدهای خطر |
|
توضیحات ایمنی |
S24/25:Avoid contact with skin and eyes.;
|
|