ChemNet > CAS > 2960-66-9 Ethyl trans-4-oxo-2-butenoate
2960-66-9 Ethyl trans-4-oxo-2-butenoate
| نام محصول |
Ethyl trans-4-oxo-2-butenoate |
| نام انگلیسی |
Ethyl trans-4-oxo-2-butenoate; Ethyl 3-formylacrylate; Ethyl fumaraldehydate; trans-4-Oxo-2-butenoic acid ethyl ester; 2-Butenoic acid,4-oxo-, ethyl ester, (2E)-; 2-Butenoicacid, 4-oxo-, ethyl ester, (E)-; Fumaraldehydic acid, ethyl ester; (2E)-4-Oxobut-2-enoic acid ethyl ester; (E)-4-Oxo-2-butenoicacid ethyl ester; (E)-Ethyl 4-oxo-2-butenoate; Ethyl (2E)-4-oxobut-2-enoate; Ethyl (E)-3-formylacrylate; Ethyltrans-4-oxo-2-butenoate; Ethyltrans-4-oxobutenoate |
| میدان مغناطیسی |
C6H8O3 |
| وزن مولکولی |
128.1259 |
| InChI |
InChI=1/C6H8O3/c1-2-9-6(8)4-3-5-7/h3-5H,2H2,1H3/b4-3+ |
| شماره سیایاس |
2960-66-9 |
| ساختار مولکولی |
|
| تراکم |
1.05g/cm3 |
| نقطه ذوب |
-9 |
| نقطه غلیان |
199.3°C at 760 mmHg |
| ضریب شکست |
1.435 |
| نقطه اشتعال |
78.6°C |
| فشار بخار |
0.343mmHg at 25°C |
| خطر نمادها |
|
| کدهای خطر |
R25:Toxic if swallowed.;
R34:Causes burns.;
R43:May cause sensitization by skin contact.;
|
| توضیحات ایمنی |
S23:Do not inhale gas/fumes/vapour/spray.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
