ChemNet > CAS > 305-15-7 2,5-Dichlorophenylhydrazine
305-15-7 2,5-Dichlorophenylhydrazine
نام محصول |
2,5-Dichlorophenylhydrazine |
نام انگلیسی |
2,5-Dichlorophenylhydrazine ; -2,5-DICHLOROPHENYLHYDRAZINE; 1-(2,5-DICHLOROPHENYL)HYDRAZINE; (2,5-dichlorophenyl)-hydrazin; Hydrazine, (2,5-dichlorophenyl)-; 2,5-DICHLOROPHENYLHYRAZINE |
میدان مغناطیسی |
C6H6Cl2N2 |
وزن مولکولی |
177.0312 |
InChI |
InChI=1/C6H6Cl2N2/c7-4-1-2-5(8)6(3-4)10-9/h1-3,10H,9H2 |
شماره سیایاس |
305-15-7 |
تعداد کمیسیون اروپایی |
206-163-6 |
ساختار مولکولی |
|
تراکم |
1.475g/cm3 |
نقطه ذوب |
100-104℃ |
نقطه غلیان |
266.8°C at 760 mmHg |
ضریب شکست |
1.665 |
نقطه اشتعال |
115.1°C |
فشار بخار |
0.00848mmHg at 25°C |
خطر نمادها |
Xi:Irritant;
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|