ChemNet > CAS > 30955-94-3 2-Acetyl-5-iodothiophene
30955-94-3 2-Acetyl-5-iodothiophene
نام محصول |
2-Acetyl-5-iodothiophene |
نام انگلیسی |
2-Acetyl-5-iodothiophene;NSC 80387; 1-(5-iodothiophen-2-yl)ethanone |
میدان مغناطیسی |
C6H5IOS |
وزن مولکولی |
252.0728 |
InChI |
InChI=1/C6H5IOS/c1-4(8)5-2-3-6(7)9-5/h2-3H,1H3 |
شماره سیایاس |
30955-94-3 |
ساختار مولکولی |
|
تراکم |
1.902g/cm3 |
نقطه غلیان |
306.2°C at 760 mmHg |
ضریب شکست |
1.637 |
نقطه اشتعال |
139°C |
فشار بخار |
0.000785mmHg at 25°C |
خطر نمادها |
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|