ChemNet > CAS > 3113-72-2 5-methyl-2-nitrobenzoic acid
3113-72-2 5-methyl-2-nitrobenzoic acid
| نام محصول |
5-methyl-2-nitrobenzoic acid |
| نام انگلیسی |
5-methyl-2-nitrobenzoic acid; 6-Nitro-m-toluic acid; 2-Nitro-5-Methylbenzoicacid; 2-Nitro-5-methylbenzoic acid |
| میدان مغناطیسی |
C8H7NO4 |
| وزن مولکولی |
181.1455 |
| InChI |
InChI=1/C8H7NO4/c1-5-2-3-6(8(10)11)7(4-5)9(12)13/h2-4H,1H3,(H,10,11) |
| شماره سیایاس |
3113-72-2 |
| تعداد کمیسیون اروپایی |
221-481-5 |
| ساختار مولکولی |
|
| تراکم |
1.392g/cm3 |
| نقطه ذوب |
134-136℃ |
| نقطه غلیان |
367.6°C at 760 mmHg |
| ضریب شکست |
1.6 |
| نقطه اشتعال |
166.8°C |
| فشار بخار |
4.72E-06mmHg at 25°C |
| خطر نمادها |
|
| کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
