ChemNet > CAS > 31431-13-7 Cyclobutyl-4-fluorophenyl ketone
31431-13-7 Cyclobutyl-4-fluorophenyl ketone
نام محصول |
Cyclobutyl-4-fluorophenyl ketone |
نام انگلیسی |
Cyclobutyl-4-fluorophenyl ketone;Cyclobutyl 4-fluorophenyl ketone; cyclobutyl(4-fluorophenyl)methanone |
میدان مغناطیسی |
C11H11FO |
وزن مولکولی |
178.2028 |
InChI |
InChI=1/C11H11FO/c12-10-6-4-9(5-7-10)11(13)8-2-1-3-8/h4-8H,1-3H2 |
شماره سیایاس |
31431-13-7 |
تعداد کمیسیون اروپایی |
250-628-6 |
ساختار مولکولی |
|
تراکم |
1.17g/cm3 |
نقطه غلیان |
268°C at 760 mmHg |
ضریب شکست |
1.544 |
نقطه اشتعال |
107.2°C |
فشار بخار |
0.00789mmHg at 25°C |
خطر نمادها |
|
کدهای خطر |
|
توضیحات ایمنی |
S24/25:Avoid contact with skin and eyes.;
|
|