ChemNet > CAS > 3147-39-5 Methyl 2,4,6-trihydroxybenzoate
3147-39-5 Methyl 2,4,6-trihydroxybenzoate
نام محصول |
Methyl 2,4,6-trihydroxybenzoate |
نام انگلیسی |
Methyl 2,4,6-trihydroxybenzoate; 2,4,6-Trihydroxybenzoic acid methyl ester; Phloroglucinolcarboxylic acid methyl ester |
میدان مغناطیسی |
C8H8O5 |
وزن مولکولی |
184.1461 |
InChI |
InChI=1/C8H8O5/c1-13-8(12)7-5(10)2-4(9)3-6(7)11/h2-3,9-11H,1H3 |
شماره سیایاس |
3147-39-5 |
تعداد کمیسیون اروپایی |
221-566-7 |
ساختار مولکولی |
|
تراکم |
1.501g/cm3 |
نقطه ذوب |
174-176℃ |
نقطه غلیان |
359.5°C at 760 mmHg |
ضریب شکست |
1.63 |
نقطه اشتعال |
150.3°C |
فشار بخار |
1.14E-05mmHg at 25°C |
خطر نمادها |
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|