ChemNet > CAS > 31736-73-9 4'-Bromo-3-chloropropiophenone
31736-73-9 4'-Bromo-3-chloropropiophenone
| نام محصول |
4'-Bromo-3-chloropropiophenone |
| نام انگلیسی |
4'-Bromo-3-chloropropiophenone; 4-Bromo-beta-chloropropiophenone; 1-(4-bromophenyl)-3-chloropropan-1-one |
| میدان مغناطیسی |
C7H4BrClO2 |
| وزن مولکولی |
235.4625 |
| InChI |
InChI=1/C7H4BrClO2/c8-5-3-4(7(10)11)1-2-6(5)9/h1-3H,(H,10,11) |
| شماره سیایاس |
31736-73-9 |
| تعداد کمیسیون اروپایی |
250-784-5 |
| ساختار مولکولی |
|
| تراکم |
1.809g/cm3 |
| نقطه ذوب |
58-61℃ |
| نقطه غلیان |
347.4°C at 760 mmHg |
| ضریب شکست |
1.621 |
| نقطه اشتعال |
163.9°C |
| فشار بخار |
2.04E-05mmHg at 25°C |
| خطر نمادها |
 Xi:Irritant;
|
| کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| توضیحات ایمنی |
S24/25:Avoid contact with skin and eyes.;
|
|
