ChemNet > CAS > 31805-83-1 1,3-Bis(methylthio)-2-propanol
31805-83-1 1,3-Bis(methylthio)-2-propanol
| نام محصول |
1,3-Bis(methylthio)-2-propanol |
| نام انگلیسی |
1,3-Bis(methylthio)-2-propanol;1,3-Bis(methylthio)propan-2-ol; 1,3-bis(methylsulfanyl)propan-2-ol |
| میدان مغناطیسی |
C5H12OS2 |
| وزن مولکولی |
152.2782 |
| InChI |
InChI=1/C5H12OS2/c1-7-3-5(6)4-8-2/h5-6H,3-4H2,1-2H3 |
| شماره سیایاس |
31805-83-1 |
| تعداد کمیسیون اروپایی |
250-814-7 |
| ساختار مولکولی |
|
| تراکم |
1.112g/cm3 |
| نقطه غلیان |
278.4°C at 760 mmHg |
| ضریب شکست |
1.536 |
| نقطه اشتعال |
135.8°C |
| فشار بخار |
0.000523mmHg at 25°C |
| خطر نمادها |
|
| کدهای خطر |
|
| توضیحات ایمنی |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|
