31909-58-7 2-Furoylacetonitrile
نام محصول |
2-Furoylacetonitrile |
نام انگلیسی |
2-Furoylacetonitrile;3-(furan-2-yl)-3-oxopropanenitrile |
میدان مغناطیسی |
C7H5NO2 |
وزن مولکولی |
135.1201 |
InChI |
InChI=1/C7H5NO2/c8-4-3-6(9)7-2-1-5-10-7/h1-2,5H,3H2 |
شماره سیایاس |
31909-58-7 |
ساختار مولکولی |
|
تراکم |
1.188g/cm3 |
نقطه ذوب |
76-83℃ |
نقطه غلیان |
297.2°C at 760 mmHg |
ضریب شکست |
1.494 |
نقطه اشتعال |
133.6°C |
فشار بخار |
0.00137mmHg at 25°C |
خطر نمادها |
Xn:Harmful;
|
کدهای خطر |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
توضیحات ایمنی |
S36/37:Wear suitable protective clothing and gloves.;
|
|