324-42-5 2-فلورو-6-متیلنافتالن؛
نام محصول |
2-فلورو-6-متیلنافتالن؛ |
نام انگلیسی |
2-fluoro-6-methylnaphthalene; |
میدان مغناطیسی |
C11H9F |
وزن مولکولی |
160.1876 |
InChI |
InChI=1/C11H9F/c1-8-2-3-10-7-11(12)5-4-9(10)6-8/h2-7H,1H3 |
شماره سیایاس |
324-42-5 |
ساختار مولکولی |
|
تراکم |
1.112g/cm3 |
نقطه ذوب |
72℃ |
نقطه غلیان |
247.5°C at 760 mmHg |
ضریب شکست |
1.594 |
نقطه اشتعال |
84.5°C |
فشار بخار |
0.0403mmHg at 25°C |
خطر نمادها |
Xi:Irritant;
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|