ChemNet > CAS > 32890-90-7 6-Chloro-2-fluoro-3-methylbenzoic acid
32890-90-7 6-Chloro-2-fluoro-3-methylbenzoic acid
نام محصول |
6-Chloro-2-fluoro-3-methylbenzoic acid |
نام انگلیسی |
6-Chloro-2-fluoro-3-methylbenzoic acid; 6-Chloro-2-fluoro-m-toluic acid |
میدان مغناطیسی |
C8H6ClFO2 |
وزن مولکولی |
188.5834 |
InChI |
InChI=1/C8H6ClFO2/c1-4-2-3-5(9)6(7(4)10)8(11)12/h2-3H,1H3,(H,11,12) |
شماره سیایاس |
32890-90-7 |
ساختار مولکولی |
|
تراکم |
1.403g/cm3 |
نقطه غلیان |
279.7°C at 760 mmHg |
ضریب شکست |
1.551 |
نقطه اشتعال |
123°C |
فشار بخار |
0.00188mmHg at 25°C |
خطر نمادها |
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|