ChemNet > CAS > 3291-03-0 3,4,5-Trimethoxybenzhydrazide
3291-03-0 3,4,5-Trimethoxybenzhydrazide
نام محصول |
3,4,5-Trimethoxybenzhydrazide |
نام انگلیسی |
3,4,5-Trimethoxybenzhydrazide;3,4,5-Trimethoxybenzohydrazide |
میدان مغناطیسی |
C10H14N2O4 |
وزن مولکولی |
226.2292 |
InChI |
InChI=1/C10H14N2O4/c1-14-7-4-6(10(13)12-11)5-8(15-2)9(7)16-3/h4-5H,11H2,1-3H3,(H,12,13) |
شماره سیایاس |
3291-03-0 |
تعداد کمیسیون اروپایی |
221-954-6 |
ساختار مولکولی |
|
تراکم |
1.197g/cm3 |
ضریب شکست |
1.534 |
خطر نمادها |
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|