ChemNet > CAS > 33733-73-2 3-Bromothioanisole
33733-73-2 3-Bromothioanisole
| نام محصول |
3-Bromothioanisole |
| نام انگلیسی |
3-Bromothioanisole; 3-Bromophenyl methyl sulphide; 3-Bromothioanisol/3-Bromophenyl methyl sulphide; 1-Bromo-3-(methylthio)benzene; m-Bromothioanisole; 1-bromo-3-(methylsulfanyl)benzene; 1-(bromosulfanyl)-3-methoxybenzene |
| میدان مغناطیسی |
C7H7BrOS |
| وزن مولکولی |
219.0989 |
| InChI |
InChI=1/C7H7BrOS/c1-9-6-3-2-4-7(5-6)10-8/h2-5H,1H3 |
| شماره سیایاس |
33733-73-2 |
| ساختار مولکولی |
|
| تراکم |
1.567g/cm3 |
| نقطه غلیان |
278.106°C at 760 mmHg |
| ضریب شکست |
1.616 |
| نقطه اشتعال |
121.995°C |
| فشار بخار |
0.007mmHg at 25°C |
| خطر نمادها |
|
| کدهای خطر |
R36/38:Irritating to eyes and skin.;
|
| توضیحات ایمنی |
S23:;
S24/25:;
|
|
