ChemNet > CAS > 337508-56-2 1- (bromomethyl) ایزوکینولین هیدروبرومید؛
337508-56-2 1- (bromomethyl) ایزوکینولین هیدروبرومید؛
| نام محصول |
1- (bromomethyl) ایزوکینولین هیدروبرومید؛ |
| نام انگلیسی |
1-(bromomethyl)isoquinoline hydrobromide; |
| میدان مغناطیسی |
C10H9Br2N |
| وزن مولکولی |
302.9932 |
| InChI |
InChI=1/C10H8BrN.BrH/c11-7-10-9-4-2-1-3-8(9)5-6-12-10;/h1-6H,7H2;1H |
| شماره سیایاس |
337508-56-2 |
| ساختار مولکولی |
|
| نقطه ذوب |
180℃ |
| نقطه غلیان |
322.1°C at 760 mmHg |
| نقطه اشتعال |
148.6°C |
| فشار بخار |
0.000536mmHg at 25°C |
| خطر نمادها |
Xi:Irritant;
|
| کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|