ChemNet > CAS > 35025-24-2 (R)-1-Ferrocenylethanol
35025-24-2 (R)-1-Ferrocenylethanol
نام محصول |
(R)-1-Ferrocenylethanol |
نام انگلیسی |
(R)-1-Ferrocenylethanol;1-cyclopenta-2,4-dienyl-[2-(1-hydroxyethyl)-1-cyclopenta-2,4-dienyl]iron |
میدان مغناطیسی |
C12H12FeO |
وزن مولکولی |
228.0681 |
InChI |
InChI=1/C7H8O.C5H4.Fe/c1-6(8)7-4-2-3-5-7;1-2-4-5-3-1;/h2-4,6,8H,1H3;1-4H;/q2*-1;+2/t6-;;/m1../s1/rC12H12FeO/c1-9(14)11-7-4-8-12(11)13-10-5-2-3-6-10/h2-9,14H,1H3/t9-/m1/s1 |
شماره سیایاس |
35025-24-2 |
ساختار مولکولی |
|
خطر نمادها |
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|