3512-17-2 2,4,6-Trifluoropyridine
نام محصول |
2,4,6-Trifluoropyridine |
نام انگلیسی |
2,4,6-Trifluoropyridine; |
میدان مغناطیسی |
C5H2F3N |
وزن مولکولی |
133.0713 |
InChI |
InChI=1/C5H2F3N/c6-3-1-4(7)9-5(8)2-3/h1-2H |
شماره سیایاس |
3512-17-2 |
ساختار مولکولی |
|
تراکم |
1.396g/cm3 |
نقطه غلیان |
121.9°C at 760 mmHg |
ضریب شکست |
1.424 |
نقطه اشتعال |
27.5°C |
فشار بخار |
17.2mmHg at 25°C |
خطر نمادها |
|
کدهای خطر |
R11:Highly flammable.;
R34:Causes burns.;
|
توضیحات ایمنی |
S16:Keep away from sources of ignition - No smoking.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|