3512-18-3 2,3,6-Trifluoropyridine
نام محصول |
2,3,6-Trifluoropyridine |
نام انگلیسی |
2,3,6-Trifluoropyridine; |
میدان مغناطیسی |
C5H2F3N |
وزن مولکولی |
133.0713 |
InChI |
InChI=1/C5H2F3N/c6-3-1-2-4(7)9-5(3)8/h1-2H |
شماره سیایاس |
3512-18-3 |
ساختار مولکولی |
|
تراکم |
1.396g/cm3 |
نقطه غلیان |
123.7°C at 760 mmHg |
ضریب شکست |
1.424 |
نقطه اشتعال |
28.6°C |
فشار بخار |
15.9mmHg at 25°C |
خطر نمادها |
|
کدهای خطر |
R10:Flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S23:Do not inhale gas/fumes/vapour/spray.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|