35354-37-1 1-Bromo-5-methylhexane
نام محصول |
1-Bromo-5-methylhexane |
نام انگلیسی |
1-Bromo-5-methylhexane; |
میدان مغناطیسی |
C7H15Br |
وزن مولکولی |
179.098 |
InChI |
InChI=1/C7H15Br/c1-7(2)5-3-4-6-8/h7H,3-6H2,1-2H3 |
شماره سیایاس |
35354-37-1 |
ساختار مولکولی |
|
تراکم |
1.136g/cm3 |
نقطه غلیان |
168°C at 760 mmHg |
ضریب شکست |
1.447 |
نقطه اشتعال |
48.4°C |
فشار بخار |
2.18mmHg at 25°C |
خطر نمادها |
|
کدهای خطر |
R10:Flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|