ChemNet > CAS > 35354-37-1 1-Bromo-5-methylhexane
35354-37-1 1-Bromo-5-methylhexane
| نام محصول |
1-Bromo-5-methylhexane |
| نام انگلیسی |
1-Bromo-5-methylhexane; |
| میدان مغناطیسی |
C7H15Br |
| وزن مولکولی |
179.098 |
| InChI |
InChI=1/C7H15Br/c1-7(2)5-3-4-6-8/h7H,3-6H2,1-2H3 |
| شماره سیایاس |
35354-37-1 |
| ساختار مولکولی |
|
| تراکم |
1.136g/cm3 |
| نقطه غلیان |
168°C at 760 mmHg |
| ضریب شکست |
1.447 |
| نقطه اشتعال |
48.4°C |
| فشار بخار |
2.18mmHg at 25°C |
| خطر نمادها |
|
| کدهای خطر |
R10:Flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
