ChemNet > CAS > 3556-83-0 Methyl 3-methoxy-4-methylbenzoate
3556-83-0 Methyl 3-methoxy-4-methylbenzoate
نام محصول |
Methyl 3-methoxy-4-methylbenzoate |
نام انگلیسی |
Methyl 3-methoxy-4-methylbenzoate; 3-Methoxy-4-methylbenzoic acid methyl ester; 3-Methoxy-p-toluic acid methyl ester (COOCH3=1); methyl 4-methoxy-3-methylbenzoate |
میدان مغناطیسی |
C10H12O3 |
وزن مولکولی |
180.2005 |
InChI |
InChI=1/C10H12O3/c1-7-6-8(10(11)13-3)4-5-9(7)12-2/h4-6H,1-3H3 |
شماره سیایاس |
3556-83-0 |
ساختار مولکولی |
|
تراکم |
1.075g/cm3 |
نقطه ذوب |
50-120℃ |
نقطه غلیان |
269.5°C at 760 mmHg |
ضریب شکست |
1.502 |
نقطه اشتعال |
107.5°C |
فشار بخار |
0.00723mmHg at 25°C |
خطر نمادها |
|
کدهای خطر |
|
توضیحات ایمنی |
S24/25:Avoid contact with skin and eyes.;
|
|