ChemNet > CAS > 35884-42-5 di(propylene glycol) butyl ether, mixture of
35884-42-5 di(propylene glycol) butyl ether, mixture of
نام محصول |
di(propylene glycol) butyl ether, mixture of |
نام انگلیسی |
di(propylene glycol) butyl ether, mixture of; Di(propylene glycol) butyl ether,mixture of isomers; 1-(3-butoxypropoxy)propan-1-ol; Dipropylene glycol butyl ether |
میدان مغناطیسی |
C10H22O3 |
وزن مولکولی |
190.2799 |
InChI |
InChI=1/C10H22O3/c1-3-5-7-12-8-6-9-13-10(11)4-2/h10-11H,3-9H2,1-2H3 |
شماره سیایاس |
35884-42-5 |
تعداد کمیسیون اروپایی |
252-776-7 |
ساختار مولکولی |
|
تراکم |
0.931g/cm3 |
نقطه غلیان |
221.1°C at 760 mmHg |
ضریب شکست |
1.435 |
نقطه اشتعال |
87.5°C |
فشار بخار |
0.0226mmHg at 25°C |
خطر نمادها |
|
کدهای خطر |
|
توضیحات ایمنی |
|
|