359-37-5 iodotrifluoroethylene
نام محصول |
iodotrifluoroethylene |
نام انگلیسی |
iodotrifluoroethylene; Trifluoroiodoethylene; 1,1,2-trifluoro-2-iodoethene |
میدان مغناطیسی |
C2F3I |
وزن مولکولی |
207.9211 |
InChI |
InChI=1/C2F3I/c3-1(4)2(5)6 |
شماره سیایاس |
359-37-5 |
تعداد کمیسیون اروپایی |
206-629-9 |
ساختار مولکولی |
|
تراکم |
2.311g/cm3 |
نقطه غلیان |
30°C at 760 mmHg |
ضریب شکست |
1.457 |
فشار بخار |
636mmHg at 25°C |
خطر نمادها |
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S23:Do not inhale gas/fumes/vapour/spray.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|