ChemNet > CAS > 36157-41-2 2,5-Dichlorothiophene-3-carboxylic acid
36157-41-2 2,5-Dichlorothiophene-3-carboxylic acid
| نام محصول |
2,5-Dichlorothiophene-3-carboxylic acid |
| نام انگلیسی |
2,5-Dichlorothiophene-3-carboxylic acid; 2,5-Dichloro-3-Thiopheneformic Acid; 2,5-dichlorothiophene-3-carboxylate |
| میدان مغناطیسی |
C5HCl2O2S |
| وزن مولکولی |
196.0318 |
| InChI |
InChI=1/C5H2Cl2O2S/c6-3-1-2(5(8)9)4(7)10-3/h1H,(H,8,9)/p-1 |
| شماره سیایاس |
36157-41-2 |
| ساختار مولکولی |
|
| نقطه غلیان |
296.6°C at 760 mmHg |
| نقطه اشتعال |
133.2°C |
| فشار بخار |
0.000641mmHg at 25°C |
| خطر نمادها |
|
| کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
