ChemNet > CAS > 36556-56-6 6-Chloro-2,4-difluoroaniline
36556-56-6 6-Chloro-2,4-difluoroaniline
| نام محصول |
6-Chloro-2,4-difluoroaniline |
| نام انگلیسی |
6-Chloro-2,4-difluoroaniline; 2-chloro-4,6-difluoroaniline |
| میدان مغناطیسی |
C6H4ClF2N |
| وزن مولکولی |
163.5525 |
| InChI |
InChI=1/C6H4ClF2N/c7-6-4(9)1-3(8)2-5(6)10/h1-2H,10H2 |
| شماره سیایاس |
36556-56-6 |
| ساختار مولکولی |
|
| تراکم |
1.459g/cm3 |
| نقطه ذوب |
28℃ |
| نقطه غلیان |
208.3°C at 760 mmHg |
| ضریب شکست |
1.543 |
| نقطه اشتعال |
92.2°C |
| فشار بخار |
0.215mmHg at 25°C |
| خطر نمادها |
 Xn:Harmful;
|
| کدهای خطر |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
