ChemNet > CAS > 37107-50-9 Cyclohexylidenecyanoacetic acid
37107-50-9 Cyclohexylidenecyanoacetic acid
نام محصول |
Cyclohexylidenecyanoacetic acid |
نام انگلیسی |
Cyclohexylidenecyanoacetic acid;Cyanocyclohexylideneacetic acid; 2-Cyano-2-cyclohexylidene-acetic acid |
میدان مغناطیسی |
C9H11NO2 |
وزن مولکولی |
165.1891 |
InChI |
InChI=1/C9H11NO2/c10-6-8(9(11)12)7-4-2-1-3-5-7/h1-5H2,(H,11,12) |
شماره سیایاس |
37107-50-9 |
تعداد کمیسیون اروپایی |
253-351-9 |
ساختار مولکولی |
|
تراکم |
1.211g/cm3 |
نقطه غلیان |
353.9°C at 760 mmHg |
ضریب شکست |
1.537 |
نقطه اشتعال |
167.8°C |
فشار بخار |
5.84E-06mmHg at 25°C |
خطر نمادها |
|
کدهای خطر |
R22:Harmful if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|