ChemNet > CAS > 374538-01-9 4-Fluoro-3-formylbenzeneboronic acid
374538-01-9 4-Fluoro-3-formylbenzeneboronic acid
نام محصول |
4-Fluoro-3-formylbenzeneboronic acid |
نام انگلیسی |
4-Fluoro-3-formylbenzeneboronic acid; 5-Borono-2-fluorobenzaldehyde; 4-Fluoro-3-formylphenylboronic acid; (4-fluoro-3-formylphenyl)boronic acid |
میدان مغناطیسی |
C7H6BFO3 |
وزن مولکولی |
167.9301 |
InChI |
InChI=1/C7H6BFO3/c9-7-2-1-6(8(11)12)3-5(7)4-10/h1-4,11-12H |
شماره سیایاس |
374538-01-9 |
ساختار مولکولی |
|
تراکم |
1.33g/cm3 |
نقطه غلیان |
342.9°C at 760 mmHg |
ضریب شکست |
1.524 |
نقطه اشتعال |
161.2°C |
فشار بخار |
2.8E-05mmHg at 25°C |
خطر نمادها |
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|