ChemNet > CAS > 37902-58-2 4-Oxo-4-phenylamino-2-butenoic acid
37902-58-2 4-Oxo-4-phenylamino-2-butenoic acid
| نام محصول |
4-Oxo-4-phenylamino-2-butenoic acid |
| نام انگلیسی |
4-Oxo-4-phenylamino-2-butenoic acid;4-Oxo-4-(phenylamino)-2-butenoic acid; 4-oxo-4-(phenylamino)but-2-enoic acid; (2E)-4-oxo-4-(phenylamino)but-2-enoic acid; (2E)-4-oxo-4-(phenylamino)but-2-enoate |
| میدان مغناطیسی |
C10H8NO3 |
| وزن مولکولی |
190.176 |
| InChI |
InChI=1/C10H9NO3/c12-9(6-7-10(13)14)11-8-4-2-1-3-5-8/h1-7H,(H,11,12)(H,13,14)/p-1/b7-6+ |
| شماره سیایاس |
37902-58-2 |
| تعداد کمیسیون اروپایی |
253-707-3 |
| ساختار مولکولی |
|
| نقطه غلیان |
442.1°C at 760 mmHg |
| نقطه اشتعال |
221.1°C |
| فشار بخار |
1.36E-08mmHg at 25°C |
| خطر نمادها |
 Xi:Irritant;
|
| کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
|
|
