ChemNet > CAS > 38071-22-6 4,5-Dibromothiophene-2-carboxaldehyde
38071-22-6 4,5-Dibromothiophene-2-carboxaldehyde
نام محصول |
4,5-Dibromothiophene-2-carboxaldehyde |
نام انگلیسی |
4,5-Dibromothiophene-2-carboxaldehyde;4,5-dibromothiophene-2-carbaldehyde |
میدان مغناطیسی |
C5H2Br2OS |
وزن مولکولی |
269.9418 |
InChI |
InChI=1/C5H2Br2OS/c6-4-1-3(2-8)9-5(4)7/h1-2H |
شماره سیایاس |
38071-22-6 |
ساختار مولکولی |
|
تراکم |
2.195g/cm3 |
نقطه ذوب |
79℃ |
نقطه غلیان |
306.1°C at 760 mmHg |
ضریب شکست |
1.685 |
نقطه اشتعال |
138.9°C |
فشار بخار |
0.00079mmHg at 25°C |
خطر نمادها |
|
کدهای خطر |
|
توضیحات ایمنی |
S24/25:Avoid contact with skin and eyes.;
|
|