ChemNet > CAS > 3855-87-6 6,8-Dibromocoumarin-3-carboxylic acid
3855-87-6 6,8-Dibromocoumarin-3-carboxylic acid
| نام محصول |
6,8-Dibromocoumarin-3-carboxylic acid |
| نام انگلیسی |
6,8-Dibromocoumarin-3-carboxylic acid; 6,8-Dibromo-2-oxo-2H-chromene-3-carboxylic acid; 2,5-difluoro-4-nitrobenzoate; 6,8-dibromo-2-oxo-2H-chromene-3-carboxylate |
| میدان مغناطیسی |
C10H3Br2O4 |
| وزن مولکولی |
346.937 |
| InChI |
InChI=1/C10H4Br2O4/c11-5-1-4-2-6(9(13)14)10(15)16-8(4)7(12)3-5/h1-3H,(H,13,14)/p-1 |
| شماره سیایاس |
3855-87-6 |
| ساختار مولکولی |
|
| نقطه ذوب |
221℃ |
| نقطه غلیان |
483.2°C at 760 mmHg |
| نقطه اشتعال |
246°C |
| فشار بخار |
3.78E-10mmHg at 25°C |
| خطر نمادها |
 Xn:Harmful;
|
| کدهای خطر |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
