ChemNet > CAS > 3857-25-8 5-Methyl-2-furanmethanol
3857-25-8 5-Methyl-2-furanmethanol
| نام محصول |
5-Methyl-2-furanmethanol |
| نام انگلیسی |
5-Methyl-2-furanmethanol; (5-Methyl-2-furyl)methanol; (5-methylfuran-2-yl)methanol |
| میدان مغناطیسی |
C6H8O2 |
| وزن مولکولی |
112.1265 |
| InChI |
InChI=1/C6H8O2/c1-5-2-3-6(4-7)8-5/h2-3,7H,4H2,1H3 |
| شماره سیایاس |
3857-25-8 |
| ساختار مولکولی |
|
| تراکم |
1.095g/cm3 |
| نقطه غلیان |
178.5°C at 760 mmHg |
| ضریب شکست |
1.494 |
| نقطه اشتعال |
61.8°C |
| فشار بخار |
0.647mmHg at 25°C |
| خطر نمادها |
 Xn:Harmful;
|
| کدهای خطر |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| توضیحات ایمنی |
S36/37:Wear suitable protective clothing and gloves.;
|
|
