ChemNet > CAS > 3893-23-0 Cyclohexylphenylacetonitrile
3893-23-0 Cyclohexylphenylacetonitrile
| نام محصول |
Cyclohexylphenylacetonitrile |
| نام انگلیسی |
Cyclohexylphenylacetonitrile; alpha-Phenylcyclohexaneacetonitrile; alpha-Cyclohexylphenylacetonitrile; (2S)-cyclohexyl(phenyl)ethanenitrile; (2R)-cyclohexyl(phenyl)ethanenitrile |
| میدان مغناطیسی |
C14H17N |
| وزن مولکولی |
199.2915 |
| InChI |
InChI=1/C14H17N/c15-11-14(12-7-3-1-4-8-12)13-9-5-2-6-10-13/h1,3-4,7-8,13-14H,2,5-6,9-10H2/t14-/m0/s1 |
| شماره سیایاس |
3893-23-0 |
| تعداد کمیسیون اروپایی |
223-442-8 |
| ساختار مولکولی |
|
| تراکم |
1.019g/cm3 |
| نقطه ذوب |
49-55℃ |
| نقطه غلیان |
322.5°C at 760 mmHg |
| ضریب شکست |
1.54 |
| نقطه اشتعال |
156.3°C |
| فشار بخار |
0.000279mmHg at 25°C |
| خطر نمادها |
 Xn:Harmful;
|
| کدهای خطر |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| توضیحات ایمنی |
S36/37:Wear suitable protective clothing and gloves.;
|
|
