ChemNet > CAS > 38939-88-7 3-Chloro-4-nitrotoluene
38939-88-7 3-Chloro-4-nitrotoluene
| نام محصول |
3-Chloro-4-nitrotoluene |
| نام انگلیسی |
3-Chloro-4-nitrotoluene;2-chloro-4-methyl-1-nitrobenzene |
| میدان مغناطیسی |
C7H6ClNO2 |
| وزن مولکولی |
171.581 |
| InChI |
InChI=1/C7H6ClNO2/c1-5-2-3-7(9(10)11)6(8)4-5/h2-4H,1H3 |
| شماره سیایاس |
38939-88-7 |
| تعداد کمیسیون اروپایی |
254-199-6 |
| ساختار مولکولی |
|
| تراکم |
1.324g/cm3 |
| نقطه ذوب |
22-27℃ |
| نقطه غلیان |
273.4°C at 760 mmHg |
| ضریب شکست |
1.57 |
| نقطه اشتعال |
119.1°C |
| فشار بخار |
0.00962mmHg at 25°C |
| خطر نمادها |
 Xn:Harmful;
|
| کدهای خطر |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
