ChemNet > CAS > 3894-09-5 Cyclohexylphenylacetic acid
3894-09-5 Cyclohexylphenylacetic acid
نام محصول |
Cyclohexylphenylacetic acid |
نام انگلیسی |
Cyclohexylphenylacetic acid; alpha-Phenylcyclohexaneacetic acid; (2R)-cyclohexyl(phenyl)ethanoate; (2S)-cyclohexyl(phenyl)ethanoate |
میدان مغناطیسی |
C14H17O2 |
وزن مولکولی |
217.2841 |
InChI |
InChI=1/C14H18O2/c15-14(16)13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1,3-4,7-8,12-13H,2,5-6,9-10H2,(H,15,16)/p-1/t13-/m1/s1 |
شماره سیایاس |
3894-09-5 |
تعداد کمیسیون اروپایی |
223-443-3 |
ساختار مولکولی |
|
نقطه ذوب |
148-151℃ |
نقطه غلیان |
353.3°C at 760 mmHg |
نقطه اشتعال |
250.2°C |
فشار بخار |
1.34E-05mmHg at 25°C |
خطر نمادها |
Xi:Irritant;
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S24/25:Avoid contact with skin and eyes.;
|
|