ChemNet > CAS > 39489-77-5 2,4-Dichloro-5-nitrophenol
39489-77-5 2,4-Dichloro-5-nitrophenol
| نام محصول |
2,4-Dichloro-5-nitrophenol |
| نام انگلیسی |
2,4-Dichloro-5-nitrophenol; |
| میدان مغناطیسی |
C6H3Cl2NO3 |
| وزن مولکولی |
207.9989 |
| InChI |
InChI=1/C6H3Cl2NO3/c7-3-1-4(8)6(10)2-5(3)9(11)12/h1-2,10H |
| شماره سیایاس |
39489-77-5 |
| ساختار مولکولی |
|
| تراکم |
1.682g/cm3 |
| نقطه غلیان |
311.2°C at 760 mmHg |
| ضریب شکست |
1.638 |
| نقطه اشتعال |
142°C |
| فشار بخار |
0.000312mmHg at 25°C |
| خطر نمادها |
|
| کدهای خطر |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
