ChemNet > CAS > 3956-63-6 2,4-Dichlorophenoxyacetonitrile
3956-63-6 2,4-Dichlorophenoxyacetonitrile
نام محصول |
2,4-Dichlorophenoxyacetonitrile |
نام انگلیسی |
2,4-Dichlorophenoxyacetonitrile; |
میدان مغناطیسی |
C8H5Cl2NO |
وزن مولکولی |
202.0374 |
InChI |
InChI=1/C8H5Cl2NO/c9-6-1-2-8(7(10)5-6)12-4-3-11/h1-2,5H,4H2 |
شماره سیایاس |
3956-63-6 |
ساختار مولکولی |
|
تراکم |
1.372g/cm3 |
نقطه ذوب |
46℃ |
نقطه غلیان |
311.8°C at 760 mmHg |
ضریب شکست |
1.555 |
نقطه اشتعال |
142.4°C |
فشار بخار |
0.000549mmHg at 25°C |
خطر نمادها |
Xn:Harmful;
|
کدهای خطر |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
توضیحات ایمنی |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|