ChemNet > CAS > 39620-02-5 5-Bromonicotinoyl chloride
39620-02-5 5-Bromonicotinoyl chloride
نام محصول |
5-Bromonicotinoyl chloride |
نام انگلیسی |
5-Bromonicotinoyl chloride; 5-Bromopyridine-3-carbonyl chloride |
میدان مغناطیسی |
C6H3BrClNO |
وزن مولکولی |
220.4511 |
InChI |
InChI=1/C6H3BrClNO/c7-5-1-4(6(8)10)2-9-3-5/h1-3H |
شماره سیایاس |
39620-02-5 |
ساختار مولکولی |
|
تراکم |
1.76g/cm3 |
نقطه ذوب |
75℃ |
نقطه غلیان |
265.4°C at 760 mmHg |
ضریب شکست |
1.59 |
نقطه اشتعال |
114.3°C |
فشار بخار |
0.00918mmHg at 25°C |
خطر نمادها |
C:Corrosive;
|
کدهای خطر |
R34:Causes burns.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|