ChemNet > CAS > 3964-57-6 Methyl 3-chloro-4-hydroxybenzoate
3964-57-6 Methyl 3-chloro-4-hydroxybenzoate
نام محصول |
Methyl 3-chloro-4-hydroxybenzoate |
نام انگلیسی |
Methyl 3-chloro-4-hydroxybenzoate; 3-Chloro-4-hydroxybenzoic acid methyl ester; Methyl 3-chloro-4-hydroxy benzoate |
میدان مغناطیسی |
C8H7ClO3 |
وزن مولکولی |
186.5924 |
InChI |
InChI=1/C8H7ClO3/c1-12-8(11)5-2-3-7(10)6(9)4-5/h2-4,10H,1H3 |
شماره سیایاس |
3964-57-6 |
تعداد کمیسیون اروپایی |
223-573-0 |
ساختار مولکولی |
|
تراکم |
1.354g/cm3 |
نقطه ذوب |
106-107℃ |
نقطه غلیان |
284.9°C at 760 mmHg |
ضریب شکست |
1.564 |
نقطه اشتعال |
126.1°C |
فشار بخار |
0.00168mmHg at 25°C |
خطر نمادها |
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|