39959-59-6 4-Iodobenzylamine
نام محصول |
4-Iodobenzylamine |
نام انگلیسی |
4-Iodobenzylamine; 4-Iodo-benzylamine; 1-(4-iodophenyl)methanamine; 4-Iodobenzyl Amine |
میدان مغناطیسی |
C7H8IN |
وزن مولکولی |
233.0496 |
InChI |
InChI=1/C7H8IN/c8-7-3-1-6(5-9)2-4-7/h1-4H,5,9H2 |
شماره سیایاس |
39959-59-6 |
ساختار مولکولی |
|
تراکم |
1.772g/cm3 |
نقطه غلیان |
250.4°C at 760 mmHg |
ضریب شکست |
1.644 |
نقطه اشتعال |
105.2°C |
فشار بخار |
0.0217mmHg at 25°C |
خطر نمادها |
|
کدهای خطر |
R34:Causes burns.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|