402-64-2 3-fluorobenzal chloride
نام محصول |
3-fluorobenzal chloride |
نام انگلیسی |
3-fluorobenzal chloride; alpha,alpha-Dichloro-3-fluorotoluene |
میدان مغناطیسی |
C7H5Cl2F |
وزن مولکولی |
179.02
|
InChI |
InChI=1/C7H5Cl2F/c8-7(9)5-2-1-3-6(10)4-5/h1-4,7H |
شماره سیایاس |
402-64-2 |
تعداد کمیسیون اروپایی |
206-952-5 |
ساختار مولکولی |
|
نقطه غلیان |
195℃ |
خطر نمادها |
|
کدهای خطر |
R34:Causes burns.;
R36:Irritating to eyes.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|