40228-90-8 7-Phenylheptanoic acid
نام محصول |
7-Phenylheptanoic acid |
نام انگلیسی |
7-Phenylheptanoic acid; |
میدان مغناطیسی |
C13H18O2 |
وزن مولکولی |
206.2808 |
InChI |
InChI=1/C13H18O2/c14-13(15)11-7-2-1-4-8-12-9-5-3-6-10-12/h3,5-6,9-10H,1-2,4,7-8,11H2,(H,14,15) |
شماره سیایاس |
40228-90-8 |
ساختار مولکولی |
|
تراکم |
1.034g/cm3 |
نقطه غلیان |
356.5°C at 760 mmHg |
ضریب شکست |
1.519 |
نقطه اشتعال |
253.5°C |
فشار بخار |
1.06E-05mmHg at 25°C |
خطر نمادها |
|
کدهای خطر |
R36/38:Irritating to eyes and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|