ChemNet > CAS > 4066-41-5 5-Acetylthiophene-2-carboxylic acid
4066-41-5 5-Acetylthiophene-2-carboxylic acid
نام محصول |
5-Acetylthiophene-2-carboxylic acid |
نام انگلیسی |
5-Acetylthiophene-2-carboxylic acid; -5-Acetyl-thiophene-2-carboxylic acid; ATC; LABOTEST-BB LT00454683; BUTTPARK 121\06-15; AKOS MSC-0226; 5-ACETYL-2-THIOPHENECARBOXYLIC ACID; RARECHEM AL BO 0535; 5-Acetylthiophene-2-CarboxylicAcid98%; 5-Acetylthiophene-2-Carboxylic Acid 98%; 5-acetylthiophene-2-carboxylate; 5-Acetyl-thiophene-2- carboxylic acid |
میدان مغناطیسی |
C7H6O3S |
وزن مولکولی |
170.1857 |
InChI |
InChI=1/C7H6O3S/c1-4(8)5-2-3-6(11-5)7(9)10/h2-3H,1H3,(H,9,10) |
شماره سیایاس |
4066-41-5 |
ساختار مولکولی |
|
تراکم |
1.383g/cm3 |
نقطه ذوب |
204-205℃ |
نقطه غلیان |
385.2°C at 760 mmHg |
ضریب شکست |
1.591 |
نقطه اشتعال |
186.8°C |
فشار بخار |
1.27E-06mmHg at 25°C |
خطر نمادها |
Xi:;
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|