4160-51-4 4'-methoxybutyrophenone
نام محصول |
4'-methoxybutyrophenone |
نام انگلیسی |
4'-methoxybutyrophenone; 1-(4-Methoxyphenyl)butan-1-on; 1-(4-Methoxyphenyl)butan-1-one; 1-Butanone, 1- (4-methoxyphenyl)-; 1-butanone, 1-(4-methoxyphenyl)-; 4'-Methoxy-butyrophenone; 4-Methoxybutyrophenone; Butyrophenone, 4'-methoxy-; p-Methoxybutyrophenone; 4-Butyrylanisole |
میدان مغناطیسی |
C11H14O2 |
وزن مولکولی |
178.2277 |
InChI |
InChI=1/C11H14O2/c1-3-4-11(12)9-5-7-10(13-2)8-6-9/h5-8H,3-4H2,1-2H3 |
شماره سیایاس |
4160-51-4 |
تعداد کمیسیون اروپایی |
223-995-5 |
ساختار مولکولی |
|
تراکم |
1.001g/cm3 |
نقطه غلیان |
288.3°C at 760 mmHg |
ضریب شکست |
1.498 |
نقطه اشتعال |
124.3°C |
فشار بخار |
0.00236mmHg at 25°C |
خطر نمادها |
|
کدهای خطر |
|
توضیحات ایمنی |
S24/25:Avoid contact with skin and eyes.;
|
|